C30H38Cl2N2O — CID 100991092
1-[3-(3,4-dichlorophenyl)-3-[3-(4-phenylpiperidin-1-yl)propyl]piperidin-1-yl]-3-methylbut-2-en-1-one (PubChem CID 100991092) has the molecular formula C30H38Cl2N2O and a molecular weight of 513.55 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)-3-[3-(4-phenylpiperidin-1-yl)propyl]piperidin-1-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[3-(3,4-dichlorophenyl)-3-[3-(4-phenylpiperidin-1-yl)propyl]piperidin-1-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 100991092 |
| Molecular Formula | C30H38Cl2N2O |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)-3-[3-(4-phenylpiperidin-1-yl)propyl]piperidin-1-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1CCCC(CCCN2CCC(c3ccccc3)CC2)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C30H38Cl2N2O/c1-23(2)20-29(35)34-17-7-15-30(22-34,26-10-11-27(31)28(32)21-26)14-6-16-33-18-12-25(13-19-33)24-8-4-3-5-9-24/h3-5,8-11,20-21,25H,6-7,12-19,22H2,1-2H3 |
| InChIKey | VYXVJCKZLVYSSB-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|