C16H21BCl2NO — CID 137328762
CID 137328762 (PubChem CID 137328762) has the molecular formula C16H21BCl2NO and a molecular weight of 325.07 g/mol.
| Compound Name | CID 137328762 |
|---|---|
| PubChem CID | 137328762 |
| Molecular Formula | C16H21BCl2NO |
| Molecular Weight | 325.07 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | — |
| SMILES | [BH]CCCC1(c2ccc(Cl)c(Cl)c2)CCCN(C(C)=O)C1 |
| InChI | InChI=1S/C16H21BCl2NO/c1-12(21)20-9-3-7-16(11-20,6-2-8-17)13-4-5-14(18)15(19)10-13/h4-5,10,17H,2-3,6-9,11H2,1H3 |
| InChIKey | KZVSAYCZMMYYEE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.07 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|