C38H49Cl2N3O — CID 57095419
[3-(3,4-dichlorophenyl)-3-[3-[4-[methyl(pentyl)amino]-4-phenylpiperidin-1-yl]propyl]piperidin-1-yl]-phenylmethanone (PubChem CID 57095419) has the molecular formula C38H49Cl2N3O and a molecular weight of 634.74 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-3-[3-[4-[methyl(pentyl)amino]-4-phenylpiperidin-1-yl]propyl]piperidin-1-yl]-phenylmethanone.
| Compound Name | [3-(3,4-dichlorophenyl)-3-[3-[4-[methyl(pentyl)amino]-4-phenylpiperidin-1-yl]propyl]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 57095419 |
| Molecular Formula | C38H49Cl2N3O |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-3-[3-[4-[methyl(pentyl)amino]-4-phenylpiperidin-1-yl]propyl]piperidin-1-yl]-phenylmethanone |
| SMILES | CCCCCN(C)C1(c2ccccc2)CCN(CCCC2(c3ccc(Cl)c(Cl)c3)CCCN(C(=O)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C38H49Cl2N3O/c1-3-4-11-24-41(2)38(32-16-9-6-10-17-32)22-27-42(28-23-38)25-12-20-37(33-18-19-34(39)35(40)29-33)21-13-26-43(30-37)36(44)31-14-7-5-8-15-31/h5-10,14-19,29H,3-4,11-13,20-28,30H2,1-2H3 |
| InChIKey | IARFASMPYGEWSF-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|