C20H21Cl2NO4S — CID 54045668
3-[1-benzoyl-3-(3,4-dichlorophenyl)pyrrolidin-3-yl]propane-1-sulfonic acid (PubChem CID 54045668) has the molecular formula C20H21Cl2NO4S and a molecular weight of 442.36 g/mol. Its IUPAC name is 3-[1-benzoyl-3-(3,4-dichlorophenyl)pyrrolidin-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[1-benzoyl-3-(3,4-dichlorophenyl)pyrrolidin-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 54045668 |
| Molecular Formula | C20H21Cl2NO4S |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 3-[1-benzoyl-3-(3,4-dichlorophenyl)pyrrolidin-3-yl]propane-1-sulfonic acid |
| SMILES | O=C(c1ccccc1)N1CCC(CCCS(=O)(=O)O)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H21Cl2NO4S/c21-17-8-7-16(13-18(17)22)20(9-4-12-28(25,26)27)10-11-23(14-20)19(24)15-5-2-1-3-6-15/h1-3,5-8,13H,4,9-12,14H2,(H,25,26,27) |
| InChIKey | LPKGVOKWLSSQSR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|