C15H14Cl2NO4- — CID 22741721
4-cyano-4-(3,4-dichlorophenyl)-7-methoxy-7-oxoheptanoate (PubChem CID 22741721) has the molecular formula C15H14Cl2NO4- and a molecular weight of 343.19 g/mol. Its IUPAC name is 4-cyano-4-(3,4-dichlorophenyl)-7-methoxy-7-oxoheptanoate.
| Compound Name | 4-cyano-4-(3,4-dichlorophenyl)-7-methoxy-7-oxoheptanoate |
|---|---|
| PubChem CID | 22741721 |
| Molecular Formula | C15H14Cl2NO4- |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 4-cyano-4-(3,4-dichlorophenyl)-7-methoxy-7-oxoheptanoate |
| SMILES | COC(=O)CCC(C#N)(CCC(=O)[O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2NO4/c1-22-14(21)5-7-15(9-18,6-4-13(19)20)10-2-3-11(16)12(17)8-10/h2-3,8H,4-7H2,1H3,(H,19,20)/p-1 |
| InChIKey | MZGHAKHDLACYAT-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 90.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |