(4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid

C13H11Cl2NO3 — CID 101140343

IUPAC(4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid
SMILESN#C[C@](CC=O)(CCC(=O)O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C13H11Cl2NO3/c14-10-2-1-9(7-11(10)15)13(8-16,5-6-17)4-3-12(18)19/h1-2,6-7H,3-5H2,(H,18,19)/t13-/m1/s1
InChIKeyYXCSKESVULGHJF-CYBMUJFWSA-N
MW300.14 g/mol
LogP3.21
Rot. Bonds6

About (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid

(4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid (PubChem CID 101140343) has the molecular formula C13H11Cl2NO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid.

Molecular Properties

Compound Name(4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid
PubChem CID101140343
Molecular FormulaC13H11Cl2NO3
Molecular Weight300.14 g/mol
Exact Mass299.01
IUPAC Name(4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid
SMILESN#C[C@](CC=O)(CCC(=O)O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C13H11Cl2NO3/c14-10-2-1-9(7-11(10)15)13(8-16,5-6-17)4-3-12(18)19/h1-2,6-7H,3-5H2,(H,18,19)/t13-/m1/s1
InChIKeyYXCSKESVULGHJF-CYBMUJFWSA-N
XLogP3.21
TPSA78.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.14
LogP ≤ 53.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid?
The IUPAC name of (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid (CID 101140343) is (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid.
What is the SMILES notation for (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid?
The canonical SMILES for (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid is N#C[C@](CC=O)(CCC(=O)O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid?
The InChIKey is YXCSKESVULGHJF-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H11Cl2NO3/c14-10-2-1-9(7-11(10)15)13(8-16,5-6-17)4-3-12(18)19/h1-2,6-7H,3-5H2,(H,18,19)/t13-/m1/s1.
What are the key properties of (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid?
(4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid has a molecular weight of 300.14 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid is sourced from PubChem (CID 101140343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).