C13H11Cl2NO3 — CID 101140343
(4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid (PubChem CID 101140343) has the molecular formula C13H11Cl2NO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid.
| Compound Name | (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 101140343 |
| Molecular Formula | C13H11Cl2NO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | (4S)-4-cyano-4-(3,4-dichlorophenyl)-6-oxohexanoic acid |
| SMILES | N#C[C@](CC=O)(CCC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO3/c14-10-2-1-9(7-11(10)15)13(8-16,5-6-17)4-3-12(18)19/h1-2,6-7H,3-5H2,(H,18,19)/t13-/m1/s1 |
| InChIKey | YXCSKESVULGHJF-CYBMUJFWSA-N |
| XLogP | 3.21 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|