C11H8Cl2N2O5 — CID 70489963
2-(3,4-dichlorophenyl)-N,N'-diformyl-2-hydroxypropanediamide (PubChem CID 70489963) has the molecular formula C11H8Cl2N2O5 and a molecular weight of 319.10 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N,N'-diformyl-2-hydroxypropanediamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N,N'-diformyl-2-hydroxypropanediamide |
|---|---|
| PubChem CID | 70489963 |
| Molecular Formula | C11H8Cl2N2O5 |
| Molecular Weight | 319.10 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N,N'-diformyl-2-hydroxypropanediamide |
| SMILES | O=CNC(=O)C(O)(C(=O)NC=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2N2O5/c12-7-2-1-6(3-8(7)13)11(20,9(18)14-4-16)10(19)15-5-17/h1-5,20H,(H,14,16,18)(H,15,17,19) |
| InChIKey | JPBOIRGVOQUSMM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.10 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|