C28H18Cl8O2 — CID 154188534
1,1,4,4-tetrakis(3,4-dichlorophenyl)butane-1,4-diol (PubChem CID 154188534) has the molecular formula C28H18Cl8O2 and a molecular weight of 670.07 g/mol. Its IUPAC name is 1,1,4,4-tetrakis(3,4-dichlorophenyl)butane-1,4-diol.
| Compound Name | 1,1,4,4-tetrakis(3,4-dichlorophenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 154188534 |
| Molecular Formula | C28H18Cl8O2 |
| Molecular Weight | 670.07 g/mol |
| Exact Mass | 665.88 |
| IUPAC Name | 1,1,4,4-tetrakis(3,4-dichlorophenyl)butane-1,4-diol |
| SMILES | OC(CCC(O)(c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1)(c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H18Cl8O2/c29-19-5-1-15(11-23(19)33)27(37,16-2-6-20(30)24(34)12-16)9-10-28(38,17-3-7-21(31)25(35)13-17)18-4-8-22(32)26(36)14-18/h1-8,11-14,37-38H,9-10H2 |
| InChIKey | BLTWAWYHQFQXPV-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.07 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |