C9H12Cl2N2O — CID 57144234
1,3-diamino-2-(3,4-dichlorophenyl)propan-2-ol (PubChem CID 57144234) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is 1,3-diamino-2-(3,4-dichlorophenyl)propan-2-ol.
| Compound Name | 1,3-diamino-2-(3,4-dichlorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 57144234 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1,3-diamino-2-(3,4-dichlorophenyl)propan-2-ol |
| SMILES | NCC(O)(CN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H12Cl2N2O/c10-7-2-1-6(3-8(7)11)9(14,4-12)5-13/h1-3,14H,4-5,12-13H2 |
| InChIKey | TYXXRYIWYMOQKZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |