C11H15Cl2NO — CID 57154824
4-amino-3-(3,4-dichlorophenyl)-3-methylbutan-1-ol (PubChem CID 57154824) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is 4-amino-3-(3,4-dichlorophenyl)-3-methylbutan-1-ol.
| Compound Name | 4-amino-3-(3,4-dichlorophenyl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 57154824 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 4-amino-3-(3,4-dichlorophenyl)-3-methylbutan-1-ol |
| SMILES | CC(CN)(CCO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2NO/c1-11(7-14,4-5-15)8-2-3-9(12)10(13)6-8/h2-3,6,15H,4-5,7,14H2,1H3 |
| InChIKey | DUZAWGHXODDFEZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |