C12H18Cl2N2O — CID 67636356
2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol (PubChem CID 67636356) has the molecular formula C12H18Cl2N2O and a molecular weight of 277.20 g/mol. Its IUPAC name is 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol.
| Compound Name | 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol |
|---|---|
| PubChem CID | 67636356 |
| Molecular Formula | C12H18Cl2N2O |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-[2-[2-(3,4-dichlorophenyl)-2-methylpropyl]hydrazinyl]ethanol |
| SMILES | CC(C)(CNNCCO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H18Cl2N2O/c1-12(2,8-16-15-5-6-17)9-3-4-10(13)11(14)7-9/h3-4,7,15-17H,5-6,8H2,1-2H3 |
| InChIKey | DDKOOIISBJXASR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|