C12H17Cl2NO — CID 66792507
(2S,3S)-4-amino-3-(3,4-dichlorophenyl)-2,3-dimethylbutan-1-ol (PubChem CID 66792507) has the molecular formula C12H17Cl2NO and a molecular weight of 262.18 g/mol. Its IUPAC name is (2S,3S)-4-amino-3-(3,4-dichlorophenyl)-2,3-dimethylbutan-1-ol.
| Compound Name | (2S,3S)-4-amino-3-(3,4-dichlorophenyl)-2,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 66792507 |
| Molecular Formula | C12H17Cl2NO |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2S,3S)-4-amino-3-(3,4-dichlorophenyl)-2,3-dimethylbutan-1-ol |
| SMILES | C[C@H](CO)[C@](C)(CN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2NO/c1-8(6-16)12(2,7-15)9-3-4-10(13)11(14)5-9/h3-5,8,16H,6-7,15H2,1-2H3/t8-,12+/m1/s1 |
| InChIKey | WNAXBBNZDGWBAX-PELKAZGASA-N |
| XLogP | 2.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |