C18H18Cl2N2O2 — CID 174358184
4-(3,4-dichlorophenyl)-6-hydroxy-2-imino-4-methyl-1-pyridin-2-ylhexan-1-one (PubChem CID 174358184) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-6-hydroxy-2-imino-4-methyl-1-pyridin-2-ylhexan-1-one.
| Compound Name | 4-(3,4-dichlorophenyl)-6-hydroxy-2-imino-4-methyl-1-pyridin-2-ylhexan-1-one |
|---|---|
| PubChem CID | 174358184 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-6-hydroxy-2-imino-4-methyl-1-pyridin-2-ylhexan-1-one |
| SMILES | [H]/N=C(/CC(C)(CCO)c1ccc(Cl)c(Cl)c1)C(=O)c1ccccn1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-18(7-9-23,12-5-6-13(19)14(20)10-12)11-15(21)17(24)16-4-2-3-8-22-16/h2-6,8,10,21,23H,7,9,11H2,1H3/b21-15- |
| InChIKey | DCJJPBYHUDKXRO-QNGOZBTKSA-N |
| XLogP | 4.32 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|