C12H7Cl2NO — CID 16638529
(2,5-dichlorophenyl)-pyridin-2-ylmethanone (PubChem CID 16638529) has the molecular formula C12H7Cl2NO and a molecular weight of 252.10 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-pyridin-2-ylmethanone.
| Compound Name | (2,5-dichlorophenyl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 16638529 |
| Molecular Formula | C12H7Cl2NO |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | (2,5-dichlorophenyl)-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H7Cl2NO/c13-8-4-5-10(14)9(7-8)12(16)11-3-1-2-6-15-11/h1-7H |
| InChIKey | VYFYNXRADGDHPE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |