C18H11Cl3N2O2S — CID 143609958
3,4-dichloro-N-[4-chloro-2-(pyridine-2-carbonyl)phenyl]benzenesulfinamide (PubChem CID 143609958) has the molecular formula C18H11Cl3N2O2S and a molecular weight of 425.72 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-chloro-2-(pyridine-2-carbonyl)phenyl]benzenesulfinamide.
| Compound Name | 3,4-dichloro-N-[4-chloro-2-(pyridine-2-carbonyl)phenyl]benzenesulfinamide |
|---|---|
| PubChem CID | 143609958 |
| Molecular Formula | C18H11Cl3N2O2S |
| Molecular Weight | 425.72 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | 3,4-dichloro-N-[4-chloro-2-(pyridine-2-carbonyl)phenyl]benzenesulfinamide |
| SMILES | O=C(c1ccccn1)c1cc(Cl)ccc1NS(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H11Cl3N2O2S/c19-11-4-7-16(13(9-11)18(24)17-3-1-2-8-22-17)23-26(25)12-5-6-14(20)15(21)10-12/h1-10,23H |
| InChIKey | JETTZENWFIYDRT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.72 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|