C15H8Cl2N2O — CID 125473502
(2,6-dichloroquinolin-4-yl)-pyridin-2-ylmethanone (PubChem CID 125473502) has the molecular formula C15H8Cl2N2O and a molecular weight of 303.15 g/mol. Its IUPAC name is (2,6-dichloroquinolin-4-yl)-pyridin-2-ylmethanone.
| Compound Name | (2,6-dichloroquinolin-4-yl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 125473502 |
| Molecular Formula | C15H8Cl2N2O |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | (2,6-dichloroquinolin-4-yl)-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)c1cc(Cl)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H8Cl2N2O/c16-9-4-5-12-10(7-9)11(8-14(17)19-12)15(20)13-3-1-2-6-18-13/h1-8H |
| InChIKey | VYXZGZTUMXBYAE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|