C11H12Cl2F3NO — CID 63083776
3-amino-2-(3,4-dichlorophenyl)-1,1,1-trifluoropentan-2-ol (PubChem CID 63083776) has the molecular formula C11H12Cl2F3NO and a molecular weight of 302.12 g/mol. Its IUPAC name is 3-amino-2-(3,4-dichlorophenyl)-1,1,1-trifluoropentan-2-ol.
| Compound Name | 3-amino-2-(3,4-dichlorophenyl)-1,1,1-trifluoropentan-2-ol |
|---|---|
| PubChem CID | 63083776 |
| Molecular Formula | C11H12Cl2F3NO |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 3-amino-2-(3,4-dichlorophenyl)-1,1,1-trifluoropentan-2-ol |
| SMILES | CCC(N)C(O)(c1ccc(Cl)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C11H12Cl2F3NO/c1-2-9(17)10(18,11(14,15)16)6-3-4-7(12)8(13)5-6/h3-5,9,18H,2,17H2,1H3 |
| InChIKey | YAHITHHQISIZBG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |