C12H13Cl2F2NO — CID 46914855
2-(3,4-dichlorophenyl)-N,N-diethyl-2,2-difluoroacetamide (PubChem CID 46914855) has the molecular formula C12H13Cl2F2NO and a molecular weight of 296.14 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N,N-diethyl-2,2-difluoroacetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N,N-diethyl-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 46914855 |
| Molecular Formula | C12H13Cl2F2NO |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N,N-diethyl-2,2-difluoroacetamide |
| SMILES | CCN(CC)C(=O)C(F)(F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2F2NO/c1-3-17(4-2)11(18)12(15,16)8-5-6-9(13)10(14)7-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | CXHFMDKWQLOASZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |