C12H13Cl2NO — CID 67695534
(2S)-2-(3,4-dichlorophenyl)-2-methylpent-4-enamide (PubChem CID 67695534) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is (2S)-2-(3,4-dichlorophenyl)-2-methylpent-4-enamide.
| Compound Name | (2S)-2-(3,4-dichlorophenyl)-2-methylpent-4-enamide |
|---|---|
| PubChem CID | 67695534 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (2S)-2-(3,4-dichlorophenyl)-2-methylpent-4-enamide |
| SMILES | C=CC[C@](C)(C(N)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO/c1-3-6-12(2,11(15)16)8-4-5-9(13)10(14)7-8/h3-5,7H,1,6H2,2H3,(H2,15,16)/t12-/m0/s1 |
| InChIKey | FPJCNTOUHIQZEM-LBPRGKRZSA-N |
| XLogP | 3.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|