C20H28Cl2N2O6 — CID 69496041
[2-(3,4-dichlorophenyl)-1-(methylamino)pent-4-en-2-yl]-(2,2-dimethylpropyl)carbamic acid;oxalic acid (PubChem CID 69496041) has the molecular formula C20H28Cl2N2O6 and a molecular weight of 463.36 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-1-(methylamino)pent-4-en-2-yl]-(2,2-dimethylpropyl)carbamic acid;oxalic acid.
| Compound Name | [2-(3,4-dichlorophenyl)-1-(methylamino)pent-4-en-2-yl]-(2,2-dimethylpropyl)carbamic acid;oxalic acid |
|---|---|
| PubChem CID | 69496041 |
| Molecular Formula | C20H28Cl2N2O6 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-1-(methylamino)pent-4-en-2-yl]-(2,2-dimethylpropyl)carbamic acid;oxalic acid |
| SMILES | C=CCC(CNC)(c1ccc(Cl)c(Cl)c1)N(CC(C)(C)C)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H26Cl2N2O2.C2H2O4/c1-6-9-18(11-21-5,13-7-8-14(19)15(20)10-13)22(16(23)24)12-17(2,3)4;3-1(4)2(5)6/h6-8,10,21H,1,9,11-12H2,2-5H3,(H,23,24);(H,3,4)(H,5,6) |
| InChIKey | KNFPDJQBNDSDJI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|