C16H19Cl2F3N2O — CID 18761079
N-[2-(3,4-dichlorophenyl)-2-(methylamino)pent-4-enyl]-3,3,3-trifluoro-N-methylpropanamide (PubChem CID 18761079) has the molecular formula C16H19Cl2F3N2O and a molecular weight of 383.24 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-2-(methylamino)pent-4-enyl]-3,3,3-trifluoro-N-methylpropanamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-2-(methylamino)pent-4-enyl]-3,3,3-trifluoro-N-methylpropanamide |
|---|---|
| PubChem CID | 18761079 |
| Molecular Formula | C16H19Cl2F3N2O |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-2-(methylamino)pent-4-enyl]-3,3,3-trifluoro-N-methylpropanamide |
| SMILES | C=CCC(CN(C)C(=O)CC(F)(F)F)(NC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2F3N2O/c1-4-7-15(22-2,11-5-6-12(17)13(18)8-11)10-23(3)14(24)9-16(19,20)21/h4-6,8,22H,1,7,9-10H2,2-3H3 |
| InChIKey | PIVZSASOUHNKSC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|