C16H16Cl3F2N2O3- — CID 23117629
N-[2-[[(2-chloro-2,2-difluoroacetyl)-methylamino]methyl]-2-(3,4-dichlorophenyl)pent-4-enyl]carbamate (PubChem CID 23117629) has the molecular formula C16H16Cl3F2N2O3- and a molecular weight of 428.67 g/mol. Its IUPAC name is N-[2-[[(2-chloro-2,2-difluoroacetyl)-methylamino]methyl]-2-(3,4-dichlorophenyl)pent-4-enyl]carbamate.
| Compound Name | N-[2-[[(2-chloro-2,2-difluoroacetyl)-methylamino]methyl]-2-(3,4-dichlorophenyl)pent-4-enyl]carbamate |
|---|---|
| PubChem CID | 23117629 |
| Molecular Formula | C16H16Cl3F2N2O3- |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | N-[2-[[(2-chloro-2,2-difluoroacetyl)-methylamino]methyl]-2-(3,4-dichlorophenyl)pent-4-enyl]carbamate |
| SMILES | C=CCC(CNC(=O)[O-])(CN(C)C(=O)C(F)(F)Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl3F2N2O3/c1-3-6-15(8-22-14(25)26,9-23(2)13(24)16(19,20)21)10-4-5-11(17)12(18)7-10/h3-5,7,22H,1,6,8-9H2,2H3,(H,25,26)/p-1 |
| InChIKey | DPVNBMAPTKJYHM-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|