C32H33Cl2NO9 — CID 131726620
2-(3,4-dichlorophenyl)-2-(methylamino)pent-4-en-1-ol;(2R,3R)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid (PubChem CID 131726620) has the molecular formula C32H33Cl2NO9 and a molecular weight of 646.52 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-2-(methylamino)pent-4-en-1-ol;(2R,3R)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid.
| Compound Name | 2-(3,4-dichlorophenyl)-2-(methylamino)pent-4-en-1-ol;(2R,3R)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid |
|---|---|
| PubChem CID | 131726620 |
| Molecular Formula | C32H33Cl2NO9 |
| Molecular Weight | 646.52 g/mol |
| Exact Mass | 645.15 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-2-(methylamino)pent-4-en-1-ol;(2R,3R)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid |
| SMILES | C=CCC(CO)(NC)c1ccc(Cl)c(Cl)c1.Cc1ccc(C(=O)[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H18O8.C12H15Cl2NO/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14;1-3-6-12(8-16,15-2)9-4-5-10(13)11(14)7-9/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26);3-5,7,15-16H,1,6,8H2,2H3/t19-,20-;/m1./s1 |
| InChIKey | UIXLWXNFVGZKOK-GZJHNZOKSA-N |
| XLogP | 3.98 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|