C21H22O11S — CID 172769948
2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;methanesulfonic acid (PubChem CID 172769948) has the molecular formula C21H22O11S and a molecular weight of 482.46 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;methanesulfonic acid.
| Compound Name | 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 172769948 |
| Molecular Formula | C21H22O11S |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1ccc(C(=O)C(O)(C(=O)O)C(O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H18O8.CH4O3S/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14;1-5(2,3)4/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26);1H3,(H,2,3,4) |
| InChIKey | MUYQQXSLIXRHSV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 203.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|