C16H18O5S — CID 90969067
methanesulfonic acid;1-[4-(4-methylphenoxy)phenyl]ethanone (PubChem CID 90969067) has the molecular formula C16H18O5S and a molecular weight of 322.38 g/mol. Its IUPAC name is methanesulfonic acid;1-[4-(4-methylphenoxy)phenyl]ethanone.
| Compound Name | methanesulfonic acid;1-[4-(4-methylphenoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 90969067 |
| Molecular Formula | C16H18O5S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | methanesulfonic acid;1-[4-(4-methylphenoxy)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Oc2ccc(C)cc2)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C15H14O2.CH4O3S/c1-11-3-7-14(8-4-11)17-15-9-5-13(6-10-15)12(2)16;1-5(2,3)4/h3-10H,1-2H3;1H3,(H,2,3,4) |
| InChIKey | AURJHIKVMOAORA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|