C43H40O9S — CID 158564217
methanesulfonic acid;bis(1-[4-[4-(4-methylphenoxy)phenoxy]phenyl]ethanone) (PubChem CID 158564217) has the molecular formula C43H40O9S and a molecular weight of 732.85 g/mol. Its IUPAC name is methanesulfonic acid;bis(1-[4-[4-(4-methylphenoxy)phenoxy]phenyl]ethanone).
| Compound Name | methanesulfonic acid;bis(1-[4-[4-(4-methylphenoxy)phenoxy]phenyl]ethanone) |
|---|---|
| PubChem CID | 158564217 |
| Molecular Formula | C43H40O9S |
| Molecular Weight | 732.85 g/mol |
| Exact Mass | 732.24 |
| IUPAC Name | methanesulfonic acid;bis(1-[4-[4-(4-methylphenoxy)phenoxy]phenyl]ethanone) |
| SMILES | CC(=O)c1ccc(Oc2ccc(Oc3ccc(C)cc3)cc2)cc1.CC(=O)c1ccc(Oc2ccc(Oc3ccc(C)cc3)cc2)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/2C21H18O3.CH4O3S/c2*1-15-3-7-18(8-4-15)23-20-11-13-21(14-12-20)24-19-9-5-17(6-10-19)16(2)22;1-5(2,3)4/h2*3-14H,1-2H3;1H3,(H,2,3,4) |
| InChIKey | KSWFVDMKIHVSFY-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.85 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|