C23H24Cl4O4 — CID 162063253
methyl 2-(3,4-dichlorophenyl)-2-methylpent-4-enoate;methyl 2-(3,4-dichlorophenyl)propanoate (PubChem CID 162063253) has the molecular formula C23H24Cl4O4 and a molecular weight of 506.25 g/mol. Its IUPAC name is methyl 2-(3,4-dichlorophenyl)-2-methylpent-4-enoate;methyl 2-(3,4-dichlorophenyl)propanoate.
| Compound Name | methyl 2-(3,4-dichlorophenyl)-2-methylpent-4-enoate;methyl 2-(3,4-dichlorophenyl)propanoate |
|---|---|
| PubChem CID | 162063253 |
| Molecular Formula | C23H24Cl4O4 |
| Molecular Weight | 506.25 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | methyl 2-(3,4-dichlorophenyl)-2-methylpent-4-enoate;methyl 2-(3,4-dichlorophenyl)propanoate |
| SMILES | C=CCC(C)(C(=O)OC)c1ccc(Cl)c(Cl)c1.COC(=O)C(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2O2.C10H10Cl2O2/c1-4-7-13(2,12(16)17-3)9-5-6-10(14)11(15)8-9;1-6(10(13)14-2)7-3-4-8(11)9(12)5-7/h4-6,8H,1,7H2,2-3H3;3-6H,1-2H3 |
| InChIKey | ZACSBBFMKOOKKZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.25 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|