C21H25F2NO6 — CID 18973702
dimethyl 4-cyano-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]heptanedioate (PubChem CID 18973702) has the molecular formula C21H25F2NO6 and a molecular weight of 425.43 g/mol. Its IUPAC name is dimethyl 4-cyano-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]heptanedioate.
| Compound Name | dimethyl 4-cyano-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]heptanedioate |
|---|---|
| PubChem CID | 18973702 |
| Molecular Formula | C21H25F2NO6 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | dimethyl 4-cyano-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]heptanedioate |
| SMILES | COC(=O)CCC(C#N)(CCC(=O)OC)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H25F2NO6/c1-27-18(25)7-9-21(13-24,10-8-19(26)28-2)15-5-6-16(30-20(22)23)17(11-15)29-12-14-3-4-14/h5-6,11,14,20H,3-4,7-10,12H2,1-2H3 |
| InChIKey | CFKGFCOKRCXTIG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |