C16H16F2N2O5 — CID 54502547
methyl 2-[[cyano-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]methyl]amino]-2-oxoacetate (PubChem CID 54502547) has the molecular formula C16H16F2N2O5 and a molecular weight of 354.31 g/mol. Its IUPAC name is methyl 2-[[cyano-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]methyl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[[cyano-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]methyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 54502547 |
| Molecular Formula | C16H16F2N2O5 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | methyl 2-[[cyano-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]methyl]amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NC(C#N)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C16H16F2N2O5/c1-23-15(22)14(21)20-11(7-19)10-4-5-12(25-16(17)18)13(6-10)24-8-9-2-3-9/h4-6,9,11,16H,2-3,8H2,1H3,(H,20,21) |
| InChIKey | YDLOMIHJHQJIPV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|