C19H24F2N2O5 — CID 175911288
methyl (2S,4S)-1-acetyl-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]pyrrolidine-2-carboxylate (PubChem CID 175911288) has the molecular formula C19H24F2N2O5 and a molecular weight of 398.41 g/mol. Its IUPAC name is methyl (2S,4S)-1-acetyl-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-acetyl-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 175911288 |
| Molecular Formula | C19H24F2N2O5 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | methyl (2S,4S)-1-acetyl-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](Nc2ccc(OC(F)F)c(OCC3CC3)c2)CN1C(C)=O |
| InChI | InChI=1S/C19H24F2N2O5/c1-11(24)23-9-14(7-15(23)18(25)26-2)22-13-5-6-16(28-19(20)21)17(8-13)27-10-12-3-4-12/h5-6,8,12,14-15,19,22H,3-4,7,9-10H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | MJDGUODRSGBSLQ-GJZGRUSLSA-N |
| XLogP | 2.65 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|