C16H22ClF2N5O2 — CID 175430732
5-(azidomethyl)-N-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 175430732) has the molecular formula C16H22ClF2N5O2 and a molecular weight of 389.83 g/mol. Its IUPAC name is 5-(azidomethyl)-N-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | 5-(azidomethyl)-N-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 175430732 |
| Molecular Formula | C16H22ClF2N5O2 |
| Molecular Weight | 389.83 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 5-(azidomethyl)-N-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.[N-]=[N+]=NCC1CC(Nc2ccc(OC(F)F)c(OCC3CC3)c2)CN1 |
| InChI | InChI=1S/C16H21F2N5O2.ClH/c17-16(18)25-14-4-3-11(6-15(14)24-9-10-1-2-10)22-13-5-12(20-7-13)8-21-23-19;/h3-4,6,10,12-13,16,20,22H,1-2,5,7-9H2;1H |
| InChIKey | GEYRPIMHWUQZTG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|