C16H21ClF2N4O2 — CID 175188333
(2S)-2-(azidomethyl)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pyrrolidine;hydrochloride (PubChem CID 175188333) has the molecular formula C16H21ClF2N4O2 and a molecular weight of 374.82 g/mol. Its IUPAC name is (2S)-2-(azidomethyl)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pyrrolidine;hydrochloride.
| Compound Name | (2S)-2-(azidomethyl)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 175188333 |
| Molecular Formula | C16H21ClF2N4O2 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (2S)-2-(azidomethyl)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pyrrolidine;hydrochloride |
| SMILES | Cl.[N-]=[N+]=NC[C@@H]1CC(c2ccc(OC(F)F)c(OCC3CC3)c2)CN1 |
| InChI | InChI=1S/C16H20F2N4O2.ClH/c17-16(18)24-14-4-3-11(6-15(14)23-9-10-1-2-10)12-5-13(20-7-12)8-21-22-19;/h3-4,6,10,12-13,16,20H,1-2,5,7-9H2;1H/t12?,13-;/m0./s1 |
| InChIKey | POIIWDWYFIASCL-ZEDZUCNESA-N |
| XLogP | 4.25 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|