C17H20F2N2O4 — CID 10473302
3-(cyclopropylmethoxy)-4-(difluoromethoxy)-N-[(3S)-6-oxopiperidin-3-yl]benzamide (PubChem CID 10473302) has the molecular formula C17H20F2N2O4 and a molecular weight of 354.35 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-4-(difluoromethoxy)-N-[(3S)-6-oxopiperidin-3-yl]benzamide.
| Compound Name | 3-(cyclopropylmethoxy)-4-(difluoromethoxy)-N-[(3S)-6-oxopiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 10473302 |
| Molecular Formula | C17H20F2N2O4 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-(cyclopropylmethoxy)-4-(difluoromethoxy)-N-[(3S)-6-oxopiperidin-3-yl]benzamide |
| SMILES | O=C1CC[C@H](NC(=O)c2ccc(OC(F)F)c(OCC3CC3)c2)CN1 |
| InChI | InChI=1S/C17H20F2N2O4/c18-17(19)25-13-5-3-11(7-14(13)24-9-10-1-2-10)16(23)21-12-4-6-15(22)20-8-12/h3,5,7,10,12,17H,1-2,4,6,8-9H2,(H,20,22)(H,21,23)/t12-/m0/s1 |
| InChIKey | RMHLOZPUERTNTA-LBPRGKRZSA-N |
| XLogP | 2.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |