C17H20F2N2O4 — CID 142869382
(3S)-N-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-oxopiperidine-3-carboxamide (PubChem CID 142869382) has the molecular formula C17H20F2N2O4 and a molecular weight of 354.35 g/mol. Its IUPAC name is (3S)-N-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 142869382 |
| Molecular Formula | C17H20F2N2O4 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (3S)-N-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-oxopiperidine-3-carboxamide |
| SMILES | O=C1NCCC[C@@H]1C(=O)Nc1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C17H20F2N2O4/c18-17(19)25-13-6-5-11(8-14(13)24-9-10-3-4-10)21-16(23)12-2-1-7-20-15(12)22/h5-6,8,10,12,17H,1-4,7,9H2,(H,20,22)(H,21,23)/t12-/m0/s1 |
| InChIKey | BCOKORNFWXSEOC-LBPRGKRZSA-N |
| XLogP | 2.54 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|