C14H14F4N2O4 — CID 142869347
(3S)-N-[3,4-bis(difluoromethoxy)phenyl]-2-oxopiperidine-3-carboxamide (PubChem CID 142869347) has the molecular formula C14H14F4N2O4 and a molecular weight of 350.27 g/mol. Its IUPAC name is (3S)-N-[3,4-bis(difluoromethoxy)phenyl]-2-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-N-[3,4-bis(difluoromethoxy)phenyl]-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 142869347 |
| Molecular Formula | C14H14F4N2O4 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (3S)-N-[3,4-bis(difluoromethoxy)phenyl]-2-oxopiperidine-3-carboxamide |
| SMILES | O=C1NCCC[C@@H]1C(=O)Nc1ccc(OC(F)F)c(OC(F)F)c1 |
| InChI | InChI=1S/C14H14F4N2O4/c15-13(16)23-9-4-3-7(6-10(9)24-14(17)18)20-12(22)8-2-1-5-19-11(8)21/h3-4,6,8,13-14H,1-2,5H2,(H,19,21)(H,20,22)/t8-/m0/s1 |
| InChIKey | ZPNQEUUMKGSFRL-QMMMGPOBSA-N |
| XLogP | 2.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|