C14H18N2O4 — CID 807343
(3R)-N-(2,5-dimethoxyphenyl)-2-oxopiperidine-3-carboxamide (PubChem CID 807343) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (3R)-N-(2,5-dimethoxyphenyl)-2-oxopiperidine-3-carboxamide.
| Compound Name | (3R)-N-(2,5-dimethoxyphenyl)-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 807343 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (3R)-N-(2,5-dimethoxyphenyl)-2-oxopiperidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)[C@@H]2CCCNC2=O)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-19-9-5-6-12(20-2)11(8-9)16-14(18)10-4-3-7-15-13(10)17/h5-6,8,10H,3-4,7H2,1-2H3,(H,15,17)(H,16,18)/t10-/m1/s1 |
| InChIKey | SRFJLFPOTVRMKY-SNVBAGLBSA-N |
| XLogP | 1.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|