C13H16N2O5 — CID 110696823
N-(2,5-dimethoxyphenyl)-5-oxomorpholine-3-carboxamide (PubChem CID 110696823) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-5-oxomorpholine-3-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-5-oxomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 110696823 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-5-oxomorpholine-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2COCC(=O)N2)c1 |
| InChI | InChI=1S/C13H16N2O5/c1-18-8-3-4-11(19-2)9(5-8)15-13(17)10-6-20-7-12(16)14-10/h3-5,10H,6-7H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | HMFHMGUHGPAXSC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |