C14H18N2O4S — CID 100825016
(3R)-N-(2,5-dimethoxyphenyl)-5-oxo-1,4-thiazepane-3-carboxamide (PubChem CID 100825016) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is (3R)-N-(2,5-dimethoxyphenyl)-5-oxo-1,4-thiazepane-3-carboxamide.
| Compound Name | (3R)-N-(2,5-dimethoxyphenyl)-5-oxo-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 100825016 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (3R)-N-(2,5-dimethoxyphenyl)-5-oxo-1,4-thiazepane-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)[C@@H]2CSCCC(=O)N2)c1 |
| InChI | InChI=1S/C14H18N2O4S/c1-19-9-3-4-12(20-2)10(7-9)16-14(18)11-8-21-6-5-13(17)15-11/h3-4,7,11H,5-6,8H2,1-2H3,(H,15,17)(H,16,18)/t11-/m0/s1 |
| InChIKey | YXZMYSKPTHLFAD-NSHDSACASA-N |
| XLogP | 1.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |