C12H14N2O2S — CID 100816227
(3S)-5-oxo-N-phenyl-1,4-thiazepane-3-carboxamide (PubChem CID 100816227) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is (3S)-5-oxo-N-phenyl-1,4-thiazepane-3-carboxamide.
| Compound Name | (3S)-5-oxo-N-phenyl-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 100816227 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (3S)-5-oxo-N-phenyl-1,4-thiazepane-3-carboxamide |
| SMILES | O=C1CCSC[C@H](C(=O)Nc2ccccc2)N1 |
| InChI | InChI=1S/C12H14N2O2S/c15-11-6-7-17-8-10(14-11)12(16)13-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,16)(H,14,15)/t10-/m1/s1 |
| InChIKey | HFHKNYWKHLNYKA-SNVBAGLBSA-N |
| XLogP | 1.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |