C13H15ClN2O4 — CID 110696884
N-(4-chloro-2-methoxy-5-methylphenyl)-5-oxomorpholine-3-carboxamide (PubChem CID 110696884) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-5-oxomorpholine-3-carboxamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-5-oxomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 110696884 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-5-oxomorpholine-3-carboxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)C1COCC(=O)N1 |
| InChI | InChI=1S/C13H15ClN2O4/c1-7-3-9(11(19-2)4-8(7)14)16-13(18)10-5-20-6-12(17)15-10/h3-4,10H,5-6H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | HJSCRSWJXJTBPE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |