C13H14N2O5 — CID 110696837
methyl 4-[(5-oxomorpholine-3-carbonyl)amino]benzoate (PubChem CID 110696837) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is methyl 4-[(5-oxomorpholine-3-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(5-oxomorpholine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110696837 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | methyl 4-[(5-oxomorpholine-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2COCC(=O)N2)cc1 |
| InChI | InChI=1S/C13H14N2O5/c1-19-13(18)8-2-4-9(5-3-8)14-12(17)10-6-20-7-11(16)15-10/h2-5,10H,6-7H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | RCICCHVNNNTYPY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |