C19H20N2O3 — CID 118100771
methyl 4-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]benzoate (PubChem CID 118100771) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl 4-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 118100771 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | methyl 4-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@H]2NCC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-24-19(23)14-7-9-15(10-8-14)21-18(22)17-16(11-12-20-17)13-5-3-2-4-6-13/h2-10,16-17,20H,11-12H2,1H3,(H,21,22)/t16-,17-/m0/s1 |
| InChIKey | HRADBCIGYAQEAU-IRXDYDNUSA-N |
| XLogP | 2.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |