About ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate
ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate (PubChem CID 118089034) has the molecular formula C23H25N3O3
and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate |
| PubChem CID | 118089034 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)[C@H]3NCC[C@H]3c3ccccc3)ccc2n1C |
| InChI | InChI=1S/C23H25N3O3/c1-3-29-23(28)20-14-16-13-17(9-10-19(16)26(20)2)25-22(27)21-18(11-12-24-21)15-7-5-4-6-8-15/h4-10,13-14,18,21,24H,3,11-12H2,1-2H3,(H,25,27)/t18-,21-/m0/s1 |
| InChIKey | UGOZAPPHRUNFBR-RXVVDRJESA-N |
| XLogP | 3.44 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate?
The IUPAC name of ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate (CID 118089034) is ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate.
What is the SMILES notation for ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate?
The canonical SMILES for ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate is CCOC(=O)c1cc2cc(NC(=O)[C@H]3NCC[C@H]3c3ccccc3)ccc2n1C.
What is the InChIKey of ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate?
The InChIKey is UGOZAPPHRUNFBR-RXVVDRJESA-N. The full InChI is InChI=1S/C23H25N3O3/c1-3-29-23(28)20-14-16-13-17(9-10-19(16)26(20)2)25-22(27)21-18(11-12-24-21)15-7-5-4-6-8-15/h4-10,13-14,18,21,24H,3,11-12H2,1-2H3,(H,25,27)/t18-,21-/m0/s1.
What are the key properties of ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate?
ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate has a molecular weight of 391.47 g/mol, XLogP of 3.44, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-methyl-5-[[(2S,3S)-3-phenylpyrrolidine-2-carbonyl]amino]indole-2-carboxylate is sourced from PubChem (CID 118089034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).