C20H22ClN3O3 — CID 72880313
ethyl 2-chloro-5-[(3-phenylpiperazine-1-carbonyl)amino]benzoate (PubChem CID 72880313) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is ethyl 2-chloro-5-[(3-phenylpiperazine-1-carbonyl)amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[(3-phenylpiperazine-1-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 72880313 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | ethyl 2-chloro-5-[(3-phenylpiperazine-1-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)N2CCNC(c3ccccc3)C2)ccc1Cl |
| InChI | InChI=1S/C20H22ClN3O3/c1-2-27-19(25)16-12-15(8-9-17(16)21)23-20(26)24-11-10-22-18(13-24)14-6-4-3-5-7-14/h3-9,12,18,22H,2,10-11,13H2,1H3,(H,23,26) |
| InChIKey | ACNCILCEJWTWCX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |