C17H23ClN2O4 — CID 72911921
ethyl 2-chloro-5-[[2-(ethoxymethyl)pyrrolidine-1-carbonyl]amino]benzoate (PubChem CID 72911921) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-(ethoxymethyl)pyrrolidine-1-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-(ethoxymethyl)pyrrolidine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 72911921 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | ethyl 2-chloro-5-[[2-(ethoxymethyl)pyrrolidine-1-carbonyl]amino]benzoate |
| SMILES | CCOCC1CCCN1C(=O)Nc1ccc(Cl)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-3-23-11-13-6-5-9-20(13)17(22)19-12-7-8-15(18)14(10-12)16(21)24-4-2/h7-8,10,13H,3-6,9,11H2,1-2H3,(H,19,22) |
| InChIKey | LUFBJUSEELCGKC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |