C18H21ClN2O5 — CID 21270704
ethyl 2-chloro-5-[(2-ethoxycarbonylcyclopenten-1-yl)carbamoylamino]benzoate (PubChem CID 21270704) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is ethyl 2-chloro-5-[(2-ethoxycarbonylcyclopenten-1-yl)carbamoylamino]benzoate.
| Compound Name | ethyl 2-chloro-5-[(2-ethoxycarbonylcyclopenten-1-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 21270704 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | ethyl 2-chloro-5-[(2-ethoxycarbonylcyclopenten-1-yl)carbamoylamino]benzoate |
| SMILES | CCOC(=O)C1=C(NC(=O)Nc2ccc(Cl)c(C(=O)OCC)c2)CCC1 |
| InChI | InChI=1S/C18H21ClN2O5/c1-3-25-16(22)12-6-5-7-15(12)21-18(24)20-11-8-9-14(19)13(10-11)17(23)26-4-2/h8-10H,3-7H2,1-2H3,(H2,20,21,24) |
| InChIKey | HMALGEWIOKKYSZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |