C15H21ClN2O2S — CID 100609315
ethyl 2-chloro-5-(3-methylbutylcarbamothioylamino)benzoate (PubChem CID 100609315) has the molecular formula C15H21ClN2O2S and a molecular weight of 328.87 g/mol. Its IUPAC name is ethyl 2-chloro-5-(3-methylbutylcarbamothioylamino)benzoate.
| Compound Name | ethyl 2-chloro-5-(3-methylbutylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 100609315 |
| Molecular Formula | C15H21ClN2O2S |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethyl 2-chloro-5-(3-methylbutylcarbamothioylamino)benzoate |
| SMILES | CCOC(=O)c1cc(NC(=S)NCCC(C)C)ccc1Cl |
| InChI | InChI=1S/C15H21ClN2O2S/c1-4-20-14(19)12-9-11(5-6-13(12)16)18-15(21)17-8-7-10(2)3/h5-6,9-10H,4,7-8H2,1-3H3,(H2,17,18,21) |
| InChIKey | SMWTVQVYODMLTO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|