C20H23ClN2O5S — CID 100666887
ethyl 2-chloro-5-[(2,3,4-trimethoxyphenyl)methylcarbamothioylamino]benzoate (PubChem CID 100666887) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is ethyl 2-chloro-5-[(2,3,4-trimethoxyphenyl)methylcarbamothioylamino]benzoate.
| Compound Name | ethyl 2-chloro-5-[(2,3,4-trimethoxyphenyl)methylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100666887 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | ethyl 2-chloro-5-[(2,3,4-trimethoxyphenyl)methylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=S)NCc2ccc(OC)c(OC)c2OC)ccc1Cl |
| InChI | InChI=1S/C20H23ClN2O5S/c1-5-28-19(24)14-10-13(7-8-15(14)21)23-20(29)22-11-12-6-9-16(25-2)18(27-4)17(12)26-3/h6-10H,5,11H2,1-4H3,(H2,22,23,29) |
| InChIKey | GUGVFYYPTSNBNM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|