C19H20ClNO5S — CID 38012801
ethyl 2-chloro-5-[[2-(3,4-dimethoxyphenyl)sulfanylacetyl]amino]benzoate (PubChem CID 38012801) has the molecular formula C19H20ClNO5S and a molecular weight of 409.89 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-(3,4-dimethoxyphenyl)sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-(3,4-dimethoxyphenyl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 38012801 |
| Molecular Formula | C19H20ClNO5S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | ethyl 2-chloro-5-[[2-(3,4-dimethoxyphenyl)sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CSc2ccc(OC)c(OC)c2)ccc1Cl |
| InChI | InChI=1S/C19H20ClNO5S/c1-4-26-19(23)14-9-12(5-7-15(14)20)21-18(22)11-27-13-6-8-16(24-2)17(10-13)25-3/h5-10H,4,11H2,1-3H3,(H,21,22) |
| InChIKey | PPTGWAPPZZPRBQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |