C16H15Cl2NO3S — CID 38016758
N-(2,6-dichlorophenyl)-2-(3,4-dimethoxyphenyl)sulfanylacetamide (PubChem CID 38016758) has the molecular formula C16H15Cl2NO3S and a molecular weight of 372.27 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-(3,4-dimethoxyphenyl)sulfanylacetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-(3,4-dimethoxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 38016758 |
| Molecular Formula | C16H15Cl2NO3S |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-(3,4-dimethoxyphenyl)sulfanylacetamide |
| SMILES | COc1ccc(SCC(=O)Nc2c(Cl)cccc2Cl)cc1OC |
| InChI | InChI=1S/C16H15Cl2NO3S/c1-21-13-7-6-10(8-14(13)22-2)23-9-15(20)19-16-11(17)4-3-5-12(16)18/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | IKEQLNXGIOKVDM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |